C29H29N2O6P — CID 67326077
[4-[[4-[(4-cyclohexylphenyl)carbamoyl]-2-phenyl-1,3-oxazol-5-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 67326077) has the molecular formula C29H29N2O6P and a molecular weight of 532.53 g/mol. Its IUPAC name is [4-[[4-[(4-cyclohexylphenyl)carbamoyl]-2-phenyl-1,3-oxazol-5-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[4-[(4-cyclohexylphenyl)carbamoyl]-2-phenyl-1,3-oxazol-5-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67326077 |
| Molecular Formula | C29H29N2O6P |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [4-[[4-[(4-cyclohexylphenyl)carbamoyl]-2-phenyl-1,3-oxazol-5-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1nc(-c2ccccc2)oc1Cc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C29H29N2O6P/c32-28(30-24-15-13-22(14-16-24)21-7-3-1-4-8-21)27-26(36-29(31-27)23-9-5-2-6-10-23)19-20-11-17-25(18-12-20)37-38(33,34)35/h2,5-6,9-18,21H,1,3-4,7-8,19H2,(H,30,32)(H2,33,34,35) |
| InChIKey | MFIJMJQCUUNJCN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|