C16H21ClN2OS — CID 67326181
(2R,4R,7R)-6-methyl-4-(methylsulfanylmethyl)-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;hydrochloride (PubChem CID 67326181) has the molecular formula C16H21ClN2OS and a molecular weight of 324.88 g/mol. Its IUPAC name is (2R,4R,7R)-6-methyl-4-(methylsulfanylmethyl)-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;hydrochloride.
| Compound Name | (2R,4R,7R)-6-methyl-4-(methylsulfanylmethyl)-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;hydrochloride |
|---|---|
| PubChem CID | 67326181 |
| Molecular Formula | C16H21ClN2OS |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2R,4R,7R)-6-methyl-4-(methylsulfanylmethyl)-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;hydrochloride |
| SMILES | CSC[C@H]1CN(C)[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2O1.Cl |
| InChI | InChI=1S/C16H20N2OS.ClH/c1-18-8-11(9-20-2)19-16-12-4-3-5-13-15(12)10(7-17-13)6-14(16)18;/h3-5,7,11,14,16-17H,6,8-9H2,1-2H3;1H/t11-,14-,16-;/m1./s1 |
| InChIKey | VLYDSCUSEMFWGV-GCAQHRBDSA-N |
| XLogP | 3.25 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |