C17H14N2O4 — CID 67326354
1-[5-(2,5-dioxopyrrol-1-yl)-2,4-dimethylphenyl]-3-methylpyrrole-2,5-dione (PubChem CID 67326354) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-[5-(2,5-dioxopyrrol-1-yl)-2,4-dimethylphenyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[5-(2,5-dioxopyrrol-1-yl)-2,4-dimethylphenyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 67326354 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[5-(2,5-dioxopyrrol-1-yl)-2,4-dimethylphenyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cc(N3C(=O)C=CC3=O)c(C)cc2C)C1=O |
| InChI | InChI=1S/C17H14N2O4/c1-9-6-10(2)13(19-16(22)7-11(3)17(19)23)8-12(9)18-14(20)4-5-15(18)21/h4-8H,1-3H3 |
| InChIKey | OYEDFNLDFULLKX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|