About pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine
pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine (PubChem CID 67326610) has the molecular formula C11H11N5
and a molecular weight of 213.24 g/mol. Its IUPAC name is pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 67326610 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine |
| SMILES | Nc1ncccn1.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.C4H5N3/c1-2-6-3-5-9-7(6)8-4-1;5-4-6-2-1-3-7-4/h1-5H,(H,8,9);1-3H,(H2,5,6,7) |
| InChIKey | LYVATLASMKMHPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine (CID 67326610) is pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine is Nc1ncccn1.c1cnc2[nH]ccc2c1.
What is the InChIKey of pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine?
The InChIKey is LYVATLASMKMHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C4H5N3/c1-2-6-3-5-9-7(6)8-4-1;5-4-6-2-1-3-7-4/h1-5H,(H,8,9);1-3H,(H2,5,6,7).
What are the key properties of pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine?
pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine has a molecular weight of 213.24 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-2-amine;1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 67326610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).