About 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride
4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride (PubChem CID 67326647) has the molecular formula C14H17ClO4
and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride |
| PubChem CID | 67326647 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCC1=COC=C(C2=CC=CCC2)O1 |
| InChI | InChI=1S/C14H16O4.ClH/c15-14(16)8-4-7-12-9-17-10-13(18-12)11-5-2-1-3-6-11;/h1-2,5,9-10H,3-4,6-8H2,(H,15,16);1H |
| InChIKey | WTQBIQJUZDUJQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride?
The IUPAC name of 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride (CID 67326647) is 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride.
What is the SMILES notation for 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride?
The canonical SMILES for 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride is Cl.O=C(O)CCCC1=COC=C(C2=CC=CCC2)O1.
What is the InChIKey of 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride?
The InChIKey is WTQBIQJUZDUJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4.ClH/c15-14(16)8-4-7-12-9-17-10-13(18-12)11-5-2-1-3-6-11;/h1-2,5,9-10H,3-4,6-8H2,(H,15,16);1H.
What are the key properties of 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride?
4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride has a molecular weight of 284.74 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)butanoic acid;hydrochloride is sourced from PubChem (CID 67326647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).