C6H3F3N2O2S — CID 67326663
4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carboxamide (PubChem CID 67326663) has the molecular formula C6H3F3N2O2S and a molecular weight of 224.16 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 67326663 |
| Molecular Formula | C6H3F3N2O2S |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nc(C(=O)C(F)(F)F)cs1 |
| InChI | InChI=1S/C6H3F3N2O2S/c7-6(8,9)3(12)2-1-14-5(11-2)4(10)13/h1H,(H2,10,13) |
| InChIKey | ZVYKVHMEWWJADA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |