About 6-ethenyl-2,2-diphenyloxasilinane
6-ethenyl-2,2-diphenyloxasilinane (PubChem CID 67326897) has the molecular formula C18H20OSi
and a molecular weight of 280.44 g/mol. Its IUPAC name is 6-ethenyl-2,2-diphenyloxasilinane.
Molecular Properties
| Compound Name | 6-ethenyl-2,2-diphenyloxasilinane |
| PubChem CID | 67326897 |
| Molecular Formula | C18H20OSi |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 6-ethenyl-2,2-diphenyloxasilinane |
| SMILES | C=CC1CCC[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H20OSi/c1-2-16-10-9-15-20(19-16,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h2-8,11-14,16H,1,9-10,15H2 |
| InChIKey | KISOELUYNHDUMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-2,2-diphenyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,2-diphenyloxasilinane?
The IUPAC name of 6-ethenyl-2,2-diphenyloxasilinane (CID 67326897) is 6-ethenyl-2,2-diphenyloxasilinane.
What is the SMILES notation for 6-ethenyl-2,2-diphenyloxasilinane?
The canonical SMILES for 6-ethenyl-2,2-diphenyloxasilinane is C=CC1CCC[Si](c2ccccc2)(c2ccccc2)O1.
What is the InChIKey of 6-ethenyl-2,2-diphenyloxasilinane?
The InChIKey is KISOELUYNHDUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20OSi/c1-2-16-10-9-15-20(19-16,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h2-8,11-14,16H,1,9-10,15H2.
What are the key properties of 6-ethenyl-2,2-diphenyloxasilinane?
6-ethenyl-2,2-diphenyloxasilinane has a molecular weight of 280.44 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,2-diphenyloxasilinane is sourced from PubChem (CID 67326897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).