About 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one
1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 67327231) has the molecular formula C21H21NO2
and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one |
| PubChem CID | 67327231 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CN1C=CC=CC1.O=C1CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C15H12O2.C6H9N/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;1-7-5-3-2-4-6-7/h1-9,15H,10H2;2-5H,6H2,1H3 |
| InChIKey | JQEUEPDHHHFXQH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one?
The IUPAC name of 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one (CID 67327231) is 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one is CN1C=CC=CC1.O=C1CC(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one?
The InChIKey is JQEUEPDHHHFXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2.C6H9N/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;1-7-5-3-2-4-6-7/h1-9,15H,10H2;2-5H,6H2,1H3.
What are the key properties of 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one?
1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one has a molecular weight of 319.40 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-pyridine;2-phenyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 67327231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).