C22H33N3O6 — CID 67327397
(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-3-yl)non-6-enamide (PubChem CID 67327397) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-3-yl)non-6-enamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-3-yl)non-6-enamide |
|---|---|
| PubChem CID | 67327397 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-3-yl)non-6-enamide |
| SMILES | CO[C@@H](C(=O)NC1CNc2ccccc2N(C)C1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C22H33N3O6/c1-22(2,3)11-10-16(26)17(27)18(28)19(31-5)20(29)24-14-12-23-13-8-6-7-9-15(13)25(4)21(14)30/h6-11,14,16-19,23,26-28H,12H2,1-5H3,(H,24,29)/t14?,16-,17+,18-,19-/m1/s1 |
| InChIKey | SFLFQPACVFCECV-MSEHENTLSA-N |
| XLogP | 0.26 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|