C25H26N4O2 — CID 6732835
methyl 4-[(1S,8aR)-3-amino-7-tert-butyl-2,4,4-tricyano-6,7,8,8a-tetrahydro-1H-naphthalen-1-yl]benzoate (PubChem CID 6732835) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is methyl 4-[(1S,8aR)-3-amino-7-tert-butyl-2,4,4-tricyano-6,7,8,8a-tetrahydro-1H-naphthalen-1-yl]benzoate.
| Compound Name | methyl 4-[(1S,8aR)-3-amino-7-tert-butyl-2,4,4-tricyano-6,7,8,8a-tetrahydro-1H-naphthalen-1-yl]benzoate |
|---|---|
| PubChem CID | 6732835 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | methyl 4-[(1S,8aR)-3-amino-7-tert-butyl-2,4,4-tricyano-6,7,8,8a-tetrahydro-1H-naphthalen-1-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(C#N)=C(N)C(C#N)(C#N)C3=CCC(C(C)(C)C)C[C@@H]32)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-24(2,3)17-9-10-20-18(11-17)21(15-5-7-16(8-6-15)23(30)31-4)19(12-26)22(29)25(20,13-27)14-28/h5-8,10,17-18,21H,9,11,29H2,1-4H3/t17?,18-,21+/m0/s1 |
| InChIKey | KIYAZLDHHSOTQL-MVDKKGTRSA-N |
| XLogP | 4.34 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|