About 2-bromo-2,5-dichloro-1H-pyridine
2-bromo-2,5-dichloro-1H-pyridine (PubChem CID 67328469) has the molecular formula C5H4BrCl2N
and a molecular weight of 228.90 g/mol. Its IUPAC name is 2-bromo-2,5-dichloro-1H-pyridine.
Molecular Properties
| Compound Name | 2-bromo-2,5-dichloro-1H-pyridine |
| PubChem CID | 67328469 |
| Molecular Formula | C5H4BrCl2N |
| Molecular Weight | 228.90 g/mol |
| Exact Mass | 226.89 |
| IUPAC Name | 2-bromo-2,5-dichloro-1H-pyridine |
| SMILES | ClC1=CNC(Cl)(Br)C=C1 |
| InChI | InChI=1S/C5H4BrCl2N/c6-5(8)2-1-4(7)3-9-5/h1-3,9H |
| InChIKey | DQDONICRLLEDKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.90 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2,5-dichloro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2,5-dichloro-1H-pyridine?
The IUPAC name of 2-bromo-2,5-dichloro-1H-pyridine (CID 67328469) is 2-bromo-2,5-dichloro-1H-pyridine.
What is the SMILES notation for 2-bromo-2,5-dichloro-1H-pyridine?
The canonical SMILES for 2-bromo-2,5-dichloro-1H-pyridine is ClC1=CNC(Cl)(Br)C=C1.
What is the InChIKey of 2-bromo-2,5-dichloro-1H-pyridine?
The InChIKey is DQDONICRLLEDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrCl2N/c6-5(8)2-1-4(7)3-9-5/h1-3,9H.
What are the key properties of 2-bromo-2,5-dichloro-1H-pyridine?
2-bromo-2,5-dichloro-1H-pyridine has a molecular weight of 228.90 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2,5-dichloro-1H-pyridine is sourced from PubChem (CID 67328469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).