About (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid
(3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid (PubChem CID 67328482) has the molecular formula C8H12O3S
and a molecular weight of 188.25 g/mol. Its IUPAC name is (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
| PubChem CID | 67328482 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
| SMILES | CCS[C@@H]1COCC=C1C(=O)O |
| InChI | InChI=1S/C8H12O3S/c1-2-12-7-5-11-4-3-6(7)8(9)10/h3,7H,2,4-5H2,1H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | BMWDIFIQWHLBNT-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The IUPAC name of (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid (CID 67328482) is (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid.
What is the SMILES notation for (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The canonical SMILES for (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid is CCS[C@@H]1COCC=C1C(=O)O.
What is the InChIKey of (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The InChIKey is BMWDIFIQWHLBNT-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12O3S/c1-2-12-7-5-11-4-3-6(7)8(9)10/h3,7H,2,4-5H2,1H3,(H,9,10)/t7-/m1/s1.
What are the key properties of (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
(3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid has a molecular weight of 188.25 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid is sourced from PubChem (CID 67328482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).