About 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene
2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene (PubChem CID 67328501) has the molecular formula C22H25Br
and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene.
Molecular Properties
| Compound Name | 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene |
| PubChem CID | 67328501 |
| Molecular Formula | C22H25Br |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene |
| SMILES | Cc1ccc2c(c1-c1cc(C(C)C)cc(C(C)C)c1)C=C(Br)C2 |
| InChI | InChI=1S/C22H25Br/c1-13(2)17-8-18(14(3)4)10-19(9-17)22-15(5)6-7-16-11-20(23)12-21(16)22/h6-10,12-14H,11H2,1-5H3 |
| InChIKey | SPYKVOMABVQXBH-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene?
The IUPAC name of 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene (CID 67328501) is 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene.
What is the SMILES notation for 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene?
The canonical SMILES for 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene is Cc1ccc2c(c1-c1cc(C(C)C)cc(C(C)C)c1)C=C(Br)C2.
What is the InChIKey of 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene?
The InChIKey is SPYKVOMABVQXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25Br/c1-13(2)17-8-18(14(3)4)10-19(9-17)22-15(5)6-7-16-11-20(23)12-21(16)22/h6-10,12-14H,11H2,1-5H3.
What are the key properties of 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene?
2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene has a molecular weight of 369.35 g/mol, XLogP of 7.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[3,5-di(propan-2-yl)phenyl]-5-methyl-1H-indene is sourced from PubChem (CID 67328501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).