About 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine
5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine (PubChem CID 6732881) has the molecular formula C19H17F3N2O2
and a molecular weight of 362.35 g/mol. Its IUPAC name is 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine.
Molecular Properties
| Compound Name | 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine |
| PubChem CID | 6732881 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine |
| SMILES | COc1c(N)cc(Oc2cccc(C(F)(F)F)c2)c2nc(C)cc(C)c12 |
| InChI | InChI=1S/C19H17F3N2O2/c1-10-7-11(2)24-17-15(9-14(23)18(25-3)16(10)17)26-13-6-4-5-12(8-13)19(20,21)22/h4-9H,23H2,1-3H3 |
| InChIKey | YYCOHZGORSJICJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine?
The IUPAC name of 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine (CID 6732881) is 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine.
What is the SMILES notation for 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine?
The canonical SMILES for 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine is COc1c(N)cc(Oc2cccc(C(F)(F)F)c2)c2nc(C)cc(C)c12.
What is the InChIKey of 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine?
The InChIKey is YYCOHZGORSJICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O2/c1-10-7-11(2)24-17-15(9-14(23)18(25-3)16(10)17)26-13-6-4-5-12(8-13)19(20,21)22/h4-9H,23H2,1-3H3.
What are the key properties of 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine?
5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine has a molecular weight of 362.35 g/mol, XLogP of 5.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,4-dimethyl-8-[3-(trifluoromethyl)phenoxy]quinolin-6-amine is sourced from PubChem (CID 6732881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).