About 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile
2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile (PubChem CID 67328853) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile |
| PubChem CID | 67328853 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile |
| SMILES | N#CCc1ncn2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C13H11N3/c14-8-7-11-13-6-5-10-3-1-2-4-12(10)16(13)9-15-11/h1-4,9H,5-7H2 |
| InChIKey | UZPQFZRTVDZAIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile?
The IUPAC name of 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile (CID 67328853) is 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile.
What is the SMILES notation for 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile?
The canonical SMILES for 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile is N#CCc1ncn2c1CCc1ccccc1-2.
What is the InChIKey of 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile?
The InChIKey is UZPQFZRTVDZAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-8-7-11-13-6-5-10-3-1-2-4-12(10)16(13)9-15-11/h1-4,9H,5-7H2.
What are the key properties of 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile?
2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile has a molecular weight of 209.25 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydroimidazo[1,5-a]quinolin-3-yl)acetonitrile is sourced from PubChem (CID 67328853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).