About (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane
(E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 67329080) has the molecular formula C23H24Cl2N2O5
and a molecular weight of 479.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane |
| PubChem CID | 67329080 |
| Molecular Formula | C23H24Cl2N2O5 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Clc1ccc(OC2CC3CCC(C2)N3Cc2ccncc2)cc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H20Cl2N2O.C4H4O4/c20-18-4-3-16(11-19(18)21)24-17-9-14-1-2-15(10-17)23(14)12-13-5-7-22-8-6-13;5-3(6)1-2-4(7)8/h3-8,11,14-15,17H,1-2,9-10,12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GRAXEOOBMYLRQW-WLHGVMLRSA-N |
| XLogP | 4.67 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane?
The IUPAC name of (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane (CID 67329080) is (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane?
The canonical SMILES for (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane is Clc1ccc(OC2CC3CCC(C2)N3Cc2ccncc2)cc1Cl.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane?
The InChIKey is GRAXEOOBMYLRQW-WLHGVMLRSA-N. The full InChI is InChI=1S/C19H20Cl2N2O.C4H4O4/c20-18-4-3-16(11-19(18)21)24-17-9-14-1-2-15(10-17)23(14)12-13-5-7-22-8-6-13;5-3(6)1-2-4(7)8/h3-8,11,14-15,17H,1-2,9-10,12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane?
(E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane has a molecular weight of 479.36 g/mol, XLogP of 4.67, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;3-(3,4-dichlorophenoxy)-8-(pyridin-4-ylmethyl)-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 67329080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).