C30H33F3N4O7S — CID 67329093
5-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-N-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67329093) has the molecular formula C30H33F3N4O7S and a molecular weight of 650.68 g/mol. Its IUPAC name is 5-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-N-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-N-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67329093 |
| Molecular Formula | C30H33F3N4O7S |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 5-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-N-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N(Cc2cc(C(=O)NCc3ccc(C4=NCCN4)cc3)co2)C2CC2)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H32N4O5S.C2HF3O2/c1-18-12-24(36-3)13-19(2)26(18)38(34,35)32(23-8-9-23)16-25-14-22(17-37-25)28(33)31-15-20-4-6-21(7-5-20)27-29-10-11-30-27;3-2(4,5)1(6)7/h4-7,12-14,17,23H,8-11,15-16H2,1-3H3,(H,29,30)(H,31,33);(H,6,7) |
| InChIKey | FRXBJALBLCJRGC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |