C23H32N2O7 — CID 67329120
(2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]hept-6-enamide (PubChem CID 67329120) has the molecular formula C23H32N2O7 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]hept-6-enamide.
| Compound Name | (2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]hept-6-enamide |
|---|---|
| PubChem CID | 67329120 |
| Molecular Formula | C23H32N2O7 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]hept-6-enamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1COc2ccccc2N(C)C1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC1CCCC1 |
| InChI | InChI=1S/C23H32N2O7/c1-25-16-9-5-6-10-18(16)32-13-15(23(25)30)24-22(29)21(31-2)20(28)19(27)17(26)12-11-14-7-3-4-8-14/h5-6,9-12,14-15,17,19-21,26-28H,3-4,7-8,13H2,1-2H3,(H,24,29)/t15-,17+,19-,20+,21+/m0/s1 |
| InChIKey | BBVNAGUFRQMUIW-UJQREPKNSA-N |
| XLogP | 0.37 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|