C15H21N3 — CID 67329325
2-[4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]phenyl]ethanamine (PubChem CID 67329325) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]phenyl]ethanamine.
| Compound Name | 2-[4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 67329325 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]phenyl]ethanamine |
| SMILES | NCCc1ccc(C2=N[C@@H]3CCCC[C@H]3N2)cc1 |
| InChI | InChI=1S/C15H21N3/c16-10-9-11-5-7-12(8-6-11)15-17-13-3-1-2-4-14(13)18-15/h5-8,13-14H,1-4,9-10,16H2,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | PSXPVTWDPCKPGT-ZIAGYGMSSA-N |
| XLogP | 1.85 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |