C22H23NO3 — CID 67329758
10,11-dimethoxy-3-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2(7),5,8,10,12-hexaen-4-one (PubChem CID 67329758) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 10,11-dimethoxy-3-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2(7),5,8,10,12-hexaen-4-one.
| Compound Name | 10,11-dimethoxy-3-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2(7),5,8,10,12-hexaen-4-one |
|---|---|
| PubChem CID | 67329758 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 10,11-dimethoxy-3-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2(7),5,8,10,12-hexaen-4-one |
| SMILES | COc1cc2c3c(c4[nH]c(=O)ccc4c2cc1OC)CC1CCCC1C3 |
| InChI | InChI=1S/C22H23NO3/c1-25-19-10-16-14-6-7-21(24)23-22(14)18-9-13-5-3-4-12(13)8-15(18)17(16)11-20(19)26-2/h6-7,10-13H,3-5,8-9H2,1-2H3,(H,23,24) |
| InChIKey | IGRKTFIVWXSPAC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|