C21H17F3N6O2 — CID 67329890
1-[4-(3-cyano-2-hydrazinyl-4-pyridinyl)phenyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea (PubChem CID 67329890) has the molecular formula C21H17F3N6O2 and a molecular weight of 442.40 g/mol. Its IUPAC name is 1-[4-(3-cyano-2-hydrazinyl-4-pyridinyl)phenyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(3-cyano-2-hydrazinyl-4-pyridinyl)phenyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67329890 |
| Molecular Formula | C21H17F3N6O2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[4-(3-cyano-2-hydrazinyl-4-pyridinyl)phenyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)Nc1ccc(-c2ccnc(NN)c2C#N)cc1 |
| InChI | InChI=1S/C21H17F3N6O2/c1-32-18-7-4-13(21(22,23)24)10-17(18)29-20(31)28-14-5-2-12(3-6-14)15-8-9-27-19(30-26)16(15)11-25/h2-10H,26H2,1H3,(H,27,30)(H2,28,29,31) |
| InChIKey | JQEZYFNWDBJKKD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|