C31H33F3N4O7S — CID 67330170
[1-[2-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-1,3-oxazole-4-carbonyl]-4-[(E)-2-pyridin-3-ylethenyl]piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 67330170) has the molecular formula C31H33F3N4O7S and a molecular weight of 662.69 g/mol. Its IUPAC name is [1-[2-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-1,3-oxazole-4-carbonyl]-4-[(E)-2-pyridin-3-ylethenyl]piperidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[2-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-1,3-oxazole-4-carbonyl]-4-[(E)-2-pyridin-3-ylethenyl]piperidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67330170 |
| Molecular Formula | C31H33F3N4O7S |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | [1-[2-[[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]-1,3-oxazole-4-carbonyl]-4-[(E)-2-pyridin-3-ylethenyl]piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(C)c(S(=O)(=O)N(Cc2nc(C(=O)N3CCC(/C=C/c4cccnc4)(OC(=O)C(F)(F)F)CC3)co2)C2CC2)c(C)c1 |
| InChI | InChI=1S/C31H33F3N4O7S/c1-20-15-24(43-3)16-21(2)27(20)46(41,42)38(23-6-7-23)18-26-36-25(19-44-26)28(39)37-13-10-30(11-14-37,45-29(40)31(32,33)34)9-8-22-5-4-12-35-17-22/h4-5,8-9,12,15-17,19,23H,6-7,10-11,13-14,18H2,1-3H3/b9-8+ |
| InChIKey | OEQVLTGYTUTIPU-CMDGGOBGSA-N |
| XLogP | 4.84 |
| TPSA | 132.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |