About 5,10,15-triphenyl-21H-corrin
5,10,15-triphenyl-21H-corrin (PubChem CID 67330602) has the molecular formula C37H24N4
and a molecular weight of 524.63 g/mol. Its IUPAC name is 5,10,15-triphenyl-21H-corrin.
Molecular Properties
| Compound Name | 5,10,15-triphenyl-21H-corrin |
| PubChem CID | 67330602 |
| Molecular Formula | C37H24N4 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 5,10,15-triphenyl-21H-corrin |
| SMILES | C1=C/C2=C(\c3ccccc3)C3=N/C(=c4/cc/c([nH]4)=C(\c4ccccc4)C4=N/C(=C(/c5ccccc5)C1=N2)C=C4)C=C3 |
| InChI | InChI=1S/C37H24N4/c1-4-10-24(11-5-1)35-29-18-16-27(38-29)28-17-19-30(39-28)36(25-12-6-2-7-13-25)32-21-23-34(41-32)37(26-14-8-3-9-15-26)33-22-20-31(35)40-33/h1-23,38H/b28-27-,35-29-,35-31-,36-30-,36-32-,37-33-,37-34- |
| InChIKey | PPEXNFRKMREHMJ-BXDIYPIMSA-N |
| XLogP | 6.19 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,10,15-triphenyl-21H-corrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10,15-triphenyl-21H-corrin?
The IUPAC name of 5,10,15-triphenyl-21H-corrin (CID 67330602) is 5,10,15-triphenyl-21H-corrin.
What is the SMILES notation for 5,10,15-triphenyl-21H-corrin?
The canonical SMILES for 5,10,15-triphenyl-21H-corrin is C1=C/C2=C(\c3ccccc3)C3=N/C(=c4/cc/c([nH]4)=C(\c4ccccc4)C4=N/C(=C(/c5ccccc5)C1=N2)C=C4)C=C3.
What is the InChIKey of 5,10,15-triphenyl-21H-corrin?
The InChIKey is PPEXNFRKMREHMJ-BXDIYPIMSA-N. The full InChI is InChI=1S/C37H24N4/c1-4-10-24(11-5-1)35-29-18-16-27(38-29)28-17-19-30(39-28)36(25-12-6-2-7-13-25)32-21-23-34(41-32)37(26-14-8-3-9-15-26)33-22-20-31(35)40-33/h1-23,38H/b28-27-,35-29-,35-31-,36-30-,36-32-,37-33-,37-34-.
What are the key properties of 5,10,15-triphenyl-21H-corrin?
5,10,15-triphenyl-21H-corrin has a molecular weight of 524.63 g/mol, XLogP of 6.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10,15-triphenyl-21H-corrin is sourced from PubChem (CID 67330602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).