C27H30N4O3SSi — CID 67330613
3-[4-(1H-indol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide (PubChem CID 67330613) has the molecular formula C27H30N4O3SSi and a molecular weight of 518.72 g/mol. Its IUPAC name is 3-[4-(1H-indol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide.
| Compound Name | 3-[4-(1H-indol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67330613 |
| Molecular Formula | C27H30N4O3SSi |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 3-[4-(1H-indol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cccc(S(N)(=O)=O)c2)cc2c(-c3cccc4[nH]ccc34)ccnc21 |
| InChI | InChI=1S/C27H30N4O3SSi/c1-36(2,3)15-14-34-18-31-26(19-6-4-7-20(16-19)35(28,32)33)17-24-22(10-13-30-27(24)31)21-8-5-9-25-23(21)11-12-29-25/h4-13,16-17,29H,14-15,18H2,1-3H3,(H2,28,32,33) |
| InChIKey | YLKIGEFVLNUFRG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|