C25H38N4O5 — CID 67331445
N-(2,3-dihydroxypropyl)-2,6-dimethyl-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide (PubChem CID 67331445) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,6-dimethyl-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,6-dimethyl-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 67331445 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,6-dimethyl-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3nc(C(C)C)no3)CC2)cc(C)c1C(=O)NCC(O)CO |
| InChI | InChI=1S/C25H38N4O5/c1-16(2)23-27-25(34-28-23)29-9-7-19(8-10-29)6-5-11-33-21-12-17(3)22(18(4)13-21)24(32)26-14-20(31)15-30/h12-13,16,19-20,30-31H,5-11,14-15H2,1-4H3,(H,26,32) |
| InChIKey | LRJXOMXMQCYYFW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|