C65H64N2 — CID 67331803
3,6-ditert-butyl-9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]carbazole (PubChem CID 67331803) has the molecular formula C65H64N2 and a molecular weight of 873.24 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 67331803 |
| Molecular Formula | C65H64N2 |
| Molecular Weight | 873.24 g/mol |
| Exact Mass | 872.51 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C2(c3ccc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C65H64N2/c1-61(2,3)43-25-33-57-51(37-43)52-38-44(62(4,5)6)26-34-58(52)66(57)47-29-21-41(22-30-47)65(55-19-15-13-17-49(55)50-18-14-16-20-56(50)65)42-23-31-48(32-24-42)67-59-35-27-45(63(7,8)9)39-53(59)54-40-46(64(10,11)12)28-36-60(54)67/h13-40H,1-12H3 |
| InChIKey | ZTGWLODJYMQPIL-UHFFFAOYSA-N |
| XLogP | 17.43 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.24 |
| LogP ≤ 5 | 17.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |