C25H33Cl2F3N8O3 — CID 67332311
N-[(2,4-dichlorophenyl)methyl]-4-[[4-(methylamino)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67332311) has the molecular formula C25H33Cl2F3N8O3 and a molecular weight of 621.49 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-4-[[4-(methylamino)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-4-[[4-(methylamino)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67332311 |
| Molecular Formula | C25H33Cl2F3N8O3 |
| Molecular Weight | 621.49 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-4-[[4-(methylamino)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNc1nc(NC2CCC(C(=O)NCc3ccc(Cl)cc3Cl)CC2)nc(N2CCN(C)CC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H32Cl2N8O.C2HF3O2/c1-26-21-29-22(31-23(30-21)33-11-9-32(2)10-12-33)28-18-7-4-15(5-8-18)20(34)27-14-16-3-6-17(24)13-19(16)25;3-2(4,5)1(6)7/h3,6,13,15,18H,4-5,7-12,14H2,1-2H3,(H,27,34)(H2,26,28,29,30,31);(H,6,7) |
| InChIKey | KDRQFWRRQVXXSW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |