About 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid
1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid (PubChem CID 67332518) has the molecular formula C20H15F3N4O3S
and a molecular weight of 448.43 g/mol. Its IUPAC name is 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid |
| PubChem CID | 67332518 |
| Molecular Formula | C20H15F3N4O3S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid |
| SMILES | CCn1c(N(c2nccs2)c2ccccc2OC(F)(F)F)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C20H15F3N4O3S/c1-2-26-14-8-7-12(17(28)29)11-13(14)25-18(26)27(19-24-9-10-31-19)15-5-3-4-6-16(15)30-20(21,22)23/h3-11H,2H2,1H3,(H,28,29) |
| InChIKey | MGSIVXKJQVMQPS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid?
The IUPAC name of 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid (CID 67332518) is 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid.
What is the SMILES notation for 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid?
The canonical SMILES for 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid is CCn1c(N(c2nccs2)c2ccccc2OC(F)(F)F)nc2cc(C(=O)O)ccc21.
What is the InChIKey of 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid?
The InChIKey is MGSIVXKJQVMQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N4O3S/c1-2-26-14-8-7-12(17(28)29)11-13(14)25-18(26)27(19-24-9-10-31-19)15-5-3-4-6-16(15)30-20(21,22)23/h3-11H,2H2,1H3,(H,28,29).
What are the key properties of 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid?
1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid has a molecular weight of 448.43 g/mol, XLogP of 5.58, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[N-(1,3-thiazol-2-yl)-2-(trifluoromethoxy)anilino]benzimidazole-5-carboxylic acid is sourced from PubChem (CID 67332518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).