About 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline
4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline (PubChem CID 67333199) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline |
| PubChem CID | 67333199 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(C(C)(C)C)ccc3o2)cc1 |
| InChI | InChI=1S/C21H26N2O/c1-6-23(7-2)17-11-8-15(9-12-17)20-22-18-14-16(21(3,4)5)10-13-19(18)24-20/h8-14H,6-7H2,1-5H3 |
| InChIKey | XOIXUNVAZNESDG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline?
The IUPAC name of 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline (CID 67333199) is 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline.
What is the SMILES notation for 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline?
The canonical SMILES for 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline is CCN(CC)c1ccc(-c2nc3cc(C(C)(C)C)ccc3o2)cc1.
What is the InChIKey of 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline?
The InChIKey is XOIXUNVAZNESDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O/c1-6-23(7-2)17-11-8-15(9-12-17)20-22-18-14-16(21(3,4)5)10-13-19(18)24-20/h8-14H,6-7H2,1-5H3.
What are the key properties of 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline?
4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline has a molecular weight of 322.45 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-tert-butyl-1,3-benzoxazol-2-yl)-N,N-diethylaniline is sourced from PubChem (CID 67333199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).