About 2-hydroxybenzoic acid;quinoline
2-hydroxybenzoic acid;quinoline (PubChem CID 67333589) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;quinoline.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;quinoline |
| PubChem CID | 67333589 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-hydroxybenzoic acid;quinoline |
| SMILES | O=C(O)c1ccccc1O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H6O3/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-4-2-1-3-5(6)7(9)10/h1-7H;1-4,8H,(H,9,10) |
| InChIKey | SZSWSPSQJWXNRB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxybenzoic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;quinoline?
The IUPAC name of 2-hydroxybenzoic acid;quinoline (CID 67333589) is 2-hydroxybenzoic acid;quinoline.
What is the SMILES notation for 2-hydroxybenzoic acid;quinoline?
The canonical SMILES for 2-hydroxybenzoic acid;quinoline is O=C(O)c1ccccc1O.c1ccc2ncccc2c1.
What is the InChIKey of 2-hydroxybenzoic acid;quinoline?
The InChIKey is SZSWSPSQJWXNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H6O3/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-4-2-1-3-5(6)7(9)10/h1-7H;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;quinoline?
2-hydroxybenzoic acid;quinoline has a molecular weight of 267.28 g/mol, XLogP of 3.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;quinoline is sourced from PubChem (CID 67333589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).