C27H34BN4O9 — CID 67333591
CID 67333591 (PubChem CID 67333591) has the molecular formula C27H34BN4O9 and a molecular weight of 569.40 g/mol.
| Compound Name | CID 67333591 |
|---|---|
| PubChem CID | 67333591 |
| Molecular Formula | C27H34BN4O9 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | — |
| SMILES | CC(NC(=O)C1CCCN1C(=O)CNC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O.O[B]O |
| InChI | InChI=1S/C27H32N4O7.BH2O2/c1-18(24(33)30-21(26(35)36)15-19-9-4-2-5-10-19)29-25(34)22-13-8-14-31(22)23(32)16-28-27(37)38-17-20-11-6-3-7-12-20;2-1-3/h2-7,9-12,18,21-22H,8,13-17H2,1H3,(H,28,37)(H,29,34)(H,30,33)(H,35,36);2-3H |
| InChIKey | WHBDEARPNRMKIS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 194.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|