C25H32N4O4 — CID 6733383
2-[3-(6-methyl-2-pyridinyl)propoxy]ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 6733383) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[3-(6-methyl-2-pyridinyl)propoxy]ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 2-[3-(6-methyl-2-pyridinyl)propoxy]ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 6733383 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-[3-(6-methyl-2-pyridinyl)propoxy]ethyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | Cc1cccc(CCCOCCOC(=O)N2CCC3(CC2)C(=O)NCN3c2ccccc2)n1 |
| InChI | InChI=1S/C25H32N4O4/c1-20-7-5-8-21(27-20)9-6-16-32-17-18-33-24(31)28-14-12-25(13-15-28)23(30)26-19-29(25)22-10-3-2-4-11-22/h2-5,7-8,10-11H,6,9,12-19H2,1H3,(H,26,30) |
| InChIKey | HKPKMLMQXRXDFY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|