About [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane
[3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane (PubChem CID 67334433) has the molecular formula C17H25BrN4O3Si
and a molecular weight of 441.40 g/mol. Its IUPAC name is [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 67334433 |
| Molecular Formula | C17H25BrN4O3Si |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(c1ccccc1)n1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C17H25BrN4O3Si/c1-17(2,3)26(4,5)25-12-11-14(13-9-7-6-8-10-13)21-15(18)19-16(20-21)22(23)24/h6-10,14H,11-12H2,1-5H3 |
| InChIKey | IEFRVJRPFORXMN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane (CID 67334433) is [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OCCC(c1ccccc1)n1nc([N+](=O)[O-])nc1Br.
What is the InChIKey of [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane?
The InChIKey is IEFRVJRPFORXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25BrN4O3Si/c1-17(2,3)26(4,5)25-12-11-14(13-9-7-6-8-10-13)21-15(18)19-16(20-21)22(23)24/h6-10,14H,11-12H2,1-5H3.
What are the key properties of [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane?
[3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane has a molecular weight of 441.40 g/mol, XLogP of 4.95, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-3-phenylpropoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 67334433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).