C31H38N2O4 — CID 67334933
(4S)-5-(1-adamantylmethylamino)-4-[[4-(3,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid (PubChem CID 67334933) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is (4S)-5-(1-adamantylmethylamino)-4-[[4-(3,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-(1-adamantylmethylamino)-4-[[4-(3,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67334933 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (4S)-5-(1-adamantylmethylamino)-4-[[4-(3,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid |
| SMILES | Cc1cc(C)cc(-c2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)NCC34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C31H38N2O4/c1-19-9-20(2)11-26(10-19)24-3-5-25(6-4-24)29(36)33-27(7-8-28(34)35)30(37)32-18-31-15-21-12-22(16-31)14-23(13-21)17-31/h3-6,9-11,21-23,27H,7-8,12-18H2,1-2H3,(H,32,37)(H,33,36)(H,34,35)/t21?,22?,23?,27-,31?/m0/s1 |
| InChIKey | AMMIQLIVOSLTEF-LIKJAAGDSA-N |
| XLogP | 5.27 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |