C28H38O5Si — CID 67335014
(2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-one (PubChem CID 67335014) has the molecular formula C28H38O5Si and a molecular weight of 482.69 g/mol. Its IUPAC name is (2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-one.
| Compound Name | (2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-one |
|---|---|
| PubChem CID | 67335014 |
| Molecular Formula | C28H38O5Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-one |
| SMILES | CC1(C)OCC(C[C@@H]2CCC(=O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C28H38O5Si/c1-27(2,3)34(23-12-8-6-9-13-23,24-14-10-7-11-15-24)31-20-26-25(29)17-16-21(32-26)18-22-19-30-28(4,5)33-22/h6-15,21-22,26H,16-20H2,1-5H3/t21-,22?,26+/m0/s1 |
| InChIKey | KADIGYTVUMLIQS-GNBZNTSPSA-N |
| XLogP | 4.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|