About 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate
2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 6733512) has the molecular formula C25H32N2O3
and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| PubChem CID | 6733512 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | Cc1ccc(CCOC(=O)NC(Cc2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-19-12-14-20(15-13-19)16-17-30-25(29)27-23(18-21-8-4-2-5-9-21)24(28)26-22-10-6-3-7-11-22/h2,4-5,8-9,12-15,22-23H,3,6-7,10-11,16-18H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | DHAKJHMGESRMFT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate?
The IUPAC name of 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (CID 6733512) is 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate.
What is the SMILES notation for 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate?
The canonical SMILES for 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate is Cc1ccc(CCOC(=O)NC(Cc2ccccc2)C(=O)NC2CCCCC2)cc1.
What is the InChIKey of 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate?
The InChIKey is DHAKJHMGESRMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O3/c1-19-12-14-20(15-13-19)16-17-30-25(29)27-23(18-21-8-4-2-5-9-21)24(28)26-22-10-6-3-7-11-22/h2,4-5,8-9,12-15,22-23H,3,6-7,10-11,16-18H2,1H3,(H,26,28)(H,27,29).
What are the key properties of 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate?
2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate has a molecular weight of 408.54 g/mol, XLogP of 4.32, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)ethyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate is sourced from PubChem (CID 6733512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).