C35H34BrN3 — CID 67335182
2-[4-(4-bromophenyl)phenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine (PubChem CID 67335182) has the molecular formula C35H34BrN3 and a molecular weight of 576.58 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)phenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(4-bromophenyl)phenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 67335182 |
| Molecular Formula | C35H34BrN3 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 2-[4-(4-bromophenyl)phenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(-c4ccc(Br)cc4)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C35H34BrN3/c1-34(2,3)28-17-11-26(12-18-28)32-37-31(25-9-7-23(8-10-25)24-15-21-30(36)22-16-24)38-33(39-32)27-13-19-29(20-14-27)35(4,5)6/h7-22H,1-6H3 |
| InChIKey | XWKBCWUGNZLCSH-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |