C25H21FO3 — CID 67335810
4-(4-fluorophenyl)-2-[(E)-2-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 67335810) has the molecular formula C25H21FO3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[(E)-2-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-(4-fluorophenyl)-2-[(E)-2-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 67335810 |
| Molecular Formula | C25H21FO3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[(E)-2-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)cc1/C=C/c1ccc2c(c1)CCC(O)C2 |
| InChI | InChI=1S/C25H21FO3/c26-22-9-5-17(6-10-22)19-8-12-24(25(28)29)21(14-19)4-2-16-1-3-20-15-23(27)11-7-18(20)13-16/h1-6,8-10,12-14,23,27H,7,11,15H2,(H,28,29)/b4-2+ |
| InChIKey | BABMRXBVDBYTGH-DUXPYHPUSA-N |
| XLogP | 5.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|