C16H20FN5O2 — CID 67336074
tert-butyl N-[5-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]carbamate (PubChem CID 67336074) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is tert-butyl N-[5-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 67336074 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl N-[5-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2n(n1)C(c1ccc(F)cc1)CNC2 |
| InChI | InChI=1S/C16H20FN5O2/c1-16(2,3)24-15(23)20-14-19-13-9-18-8-12(22(13)21-14)10-4-6-11(17)7-5-10/h4-7,12,18H,8-9H2,1-3H3,(H,20,21,23) |
| InChIKey | WNPQQBIHAMRLOT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |