About [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane
[3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 67336191) has the molecular formula C11H20BrNO2Si
and a molecular weight of 306.28 g/mol. Its IUPAC name is [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
| PubChem CID | 67336191 |
| Molecular Formula | C11H20BrNO2Si |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(CBr)no1 |
| InChI | InChI=1S/C11H20BrNO2Si/c1-11(2,3)16(4,5)14-8-10-6-9(7-12)13-15-10/h6H,7-8H2,1-5H3 |
| InChIKey | OYXBHSUYACNRES-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane?
The IUPAC name of [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane (CID 67336191) is [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane?
The canonical SMILES for [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OCc1cc(CBr)no1.
What is the InChIKey of [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane?
The InChIKey is OYXBHSUYACNRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO2Si/c1-11(2,3)16(4,5)14-8-10-6-9(7-12)13-15-10/h6H,7-8H2,1-5H3.
What are the key properties of [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane?
[3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane has a molecular weight of 306.28 g/mol, XLogP of 4.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(bromomethyl)-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 67336191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).