C12H16N2 — CID 67336349
1,2,3,4,4a,5,6,6a-octahydro-4,7-phenanthroline (PubChem CID 67336349) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a-octahydro-4,7-phenanthroline.
| Compound Name | 1,2,3,4,4a,5,6,6a-octahydro-4,7-phenanthroline |
|---|---|
| PubChem CID | 67336349 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a-octahydro-4,7-phenanthroline |
| SMILES | C1=CC2=C3CCCNC3CCC2N=C1 |
| InChI | InChI=1S/C12H16N2/c1-3-9-10-4-2-8-14-12(10)6-5-11(9)13-7-1/h1,3,7,11-12,14H,2,4-6,8H2 |
| InChIKey | NHSNPNGEZLLNFG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |