C13H29NO3Si — CID 67336555
dihydroxy-methyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane (PubChem CID 67336555) has the molecular formula C13H29NO3Si and a molecular weight of 275.46 g/mol. Its IUPAC name is dihydroxy-methyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane.
| Compound Name | dihydroxy-methyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane |
|---|---|
| PubChem CID | 67336555 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | dihydroxy-methyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane |
| SMILES | CC1(C)CC(OCCC[Si](C)(O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C13H29NO3Si/c1-12(2)9-11(10-13(3,4)14-12)17-7-6-8-18(5,15)16/h11,14-16H,6-10H2,1-5H3 |
| InChIKey | BXJOYALXIDEWIU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|