C26H25FO4 — CID 67336685
4-(4-fluorophenyl)-2-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]benzoic acid (PubChem CID 67336685) has the molecular formula C26H25FO4 and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]benzoic acid.
| Compound Name | 4-(4-fluorophenyl)-2-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]benzoic acid |
|---|---|
| PubChem CID | 67336685 |
| Molecular Formula | C26H25FO4 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)cc1OCCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C26H25FO4/c27-21-12-9-18(10-13-21)20-11-14-23(26(28)29)25(17-20)31-16-4-15-30-24-8-3-6-19-5-1-2-7-22(19)24/h3,6,8-14,17H,1-2,4-5,7,15-16H2,(H,28,29) |
| InChIKey | VTEUQGLUXBDGTH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|