About (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol
(4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol (PubChem CID 67336755) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol.
Molecular Properties
| Compound Name | (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol |
| PubChem CID | 67336755 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol |
| SMILES | C=CCOC(OCC=C)[C@@H]1C[C@@H](O)CC(O)O1 |
| InChI | InChI=1S/C12H20O5/c1-3-5-15-12(16-6-4-2)10-7-9(13)8-11(14)17-10/h3-4,9-14H,1-2,5-8H2/t9-,10+,11?/m1/s1 |
| InChIKey | IMAAYIHRPXIRIM-JKIOLJMWSA-N |
| XLogP | 0.58 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol?
The IUPAC name of (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol (CID 67336755) is (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol.
What is the SMILES notation for (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol?
The canonical SMILES for (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol is C=CCOC(OCC=C)[C@@H]1C[C@@H](O)CC(O)O1.
What is the InChIKey of (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol?
The InChIKey is IMAAYIHRPXIRIM-JKIOLJMWSA-N. The full InChI is InChI=1S/C12H20O5/c1-3-5-15-12(16-6-4-2)10-7-9(13)8-11(14)17-10/h3-4,9-14H,1-2,5-8H2/t9-,10+,11?/m1/s1.
What are the key properties of (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol?
(4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol has a molecular weight of 244.29 g/mol, XLogP of 0.58, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-6-[bis(prop-2-enoxy)methyl]oxane-2,4-diol is sourced from PubChem (CID 67336755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).