About 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate
2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 6733838) has the molecular formula C27H28N4O4
and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate |
| PubChem CID | 6733838 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C#N)c(C)nc1N1CCN(C(=O)OCCc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C27H28N4O4/c1-3-34-26(32)24-17-23(18-28)19(2)29-25(24)30-11-13-31(14-12-30)27(33)35-15-10-20-8-9-21-6-4-5-7-22(21)16-20/h4-9,16-17H,3,10-15H2,1-2H3 |
| InChIKey | NOSWUDFUFWZDQM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate?
The IUPAC name of 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate (CID 6733838) is 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate.
What is the SMILES notation for 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate?
The canonical SMILES for 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate is CCOC(=O)c1cc(C#N)c(C)nc1N1CCN(C(=O)OCCc2ccc3ccccc3c2)CC1.
What is the InChIKey of 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate?
The InChIKey is NOSWUDFUFWZDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O4/c1-3-34-26(32)24-17-23(18-28)19(2)29-25(24)30-11-13-31(14-12-30)27(33)35-15-10-20-8-9-21-6-4-5-7-22(21)16-20/h4-9,16-17H,3,10-15H2,1-2H3.
What are the key properties of 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate?
2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate has a molecular weight of 472.55 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-ylethyl 4-(5-cyano-3-ethoxycarbonyl-6-methyl-2-pyridinyl)piperazine-1-carboxylate is sourced from PubChem (CID 6733838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).