About 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine
6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine (PubChem CID 67338382) has the molecular formula C14H13BrN2
and a molecular weight of 289.18 g/mol. Its IUPAC name is 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine.
Molecular Properties
| Compound Name | 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine |
| PubChem CID | 67338382 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine |
| SMILES | BrCC1Nc2ncccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H13BrN2/c15-9-13-12-6-2-1-4-10(12)8-11-5-3-7-16-14(11)17-13/h1-7,13H,8-9H2,(H,16,17) |
| InChIKey | ZZCQKVVLDWTDMP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine?
The IUPAC name of 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine (CID 67338382) is 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine.
What is the SMILES notation for 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine?
The canonical SMILES for 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine is BrCC1Nc2ncccc2Cc2ccccc21.
What is the InChIKey of 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine?
The InChIKey is ZZCQKVVLDWTDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2/c15-9-13-12-6-2-1-4-10(12)8-11-5-3-7-16-14(11)17-13/h1-7,13H,8-9H2,(H,16,17).
What are the key properties of 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine?
6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine has a molecular weight of 289.18 g/mol, XLogP of 3.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine is sourced from PubChem (CID 67338382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).