C14H11NO4 — CID 67338559
3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)pyrrole-2,5-dione (PubChem CID 67338559) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67338559 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(C2=COC=C(C3=CC=CCC3)O2)C(=O)N1 |
| InChI | InChI=1S/C14H11NO4/c16-13-6-10(14(17)15-13)12-8-18-7-11(19-12)9-4-2-1-3-5-9/h1-2,4,6-8H,3,5H2,(H,15,16,17) |
| InChIKey | MGZPIWUGUYEYSR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|