C23H24Cl2F2N4O4S — CID 67338825
3-amino-1-(2,4-dichlorophenyl)sulfonyl-6-[(3,4-difluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 67338825) has the molecular formula C23H24Cl2F2N4O4S and a molecular weight of 561.44 g/mol. Its IUPAC name is 3-amino-1-(2,4-dichlorophenyl)sulfonyl-6-[(3,4-difluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 3-amino-1-(2,4-dichlorophenyl)sulfonyl-6-[(3,4-difluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 67338825 |
| Molecular Formula | C23H24Cl2F2N4O4S |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 3-amino-1-(2,4-dichlorophenyl)sulfonyl-6-[(3,4-difluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(N)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C23H24Cl2F2N4O4S/c1-12(2)29-11-21-30(36(34,35)20-6-4-14(24)9-15(20)25)10-18(28)22(32)31(21)19(23(29)33)8-13-3-5-16(26)17(27)7-13/h3-7,9,12,18-19,21H,8,10-11,28H2,1-2H3 |
| InChIKey | QRYBUFBVKZGQKB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |