C24H34BFN4O4 — CID 67339682
tert-butyl N-[(3S)-1-[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamate (PubChem CID 67339682) has the molecular formula C24H34BFN4O4 and a molecular weight of 472.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67339682 |
| Molecular Formula | C24H34BFN4O4 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | tert-butyl N-[(3S)-1-[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2c(F)cnc3cnc(B4OC(C)(C)C(C)(C)O4)cc23)C1 |
| InChI | InChI=1S/C24H34BFN4O4/c1-22(2,3)32-21(31)29-15-9-8-10-30(14-15)20-16-11-19(28-13-18(16)27-12-17(20)26)25-33-23(4,5)24(6,7)34-25/h11-13,15H,8-10,14H2,1-7H3,(H,29,31)/t15-/m0/s1 |
| InChIKey | UZXOFQZDRJVAPO-HNNXBMFYSA-N |
| XLogP | 3.56 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|