C15H16F4N4O3 — CID 67339786
5-fluoro-2-piperidin-1-ium-4-ylindazole-7-carboxamide;2,2,2-trifluoroacetate (PubChem CID 67339786) has the molecular formula C15H16F4N4O3 and a molecular weight of 376.31 g/mol. Its IUPAC name is 5-fluoro-2-piperidin-1-ium-4-ylindazole-7-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 5-fluoro-2-piperidin-1-ium-4-ylindazole-7-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67339786 |
| Molecular Formula | C15H16F4N4O3 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-fluoro-2-piperidin-1-ium-4-ylindazole-7-carboxamide;2,2,2-trifluoroacetate |
| SMILES | NC(=O)c1cc(F)cc2cn(C3CC[NH2+]CC3)nc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H15FN4O.C2HF3O2/c14-9-5-8-7-18(10-1-3-16-4-2-10)17-12(8)11(6-9)13(15)19;3-2(4,5)1(6)7/h5-7,10,16H,1-4H2,(H2,15,19);(H,6,7) |
| InChIKey | WCWULPBCIKUUSP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |